C22H28N2OS — CID 132655322
N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-methylsulfanylbenzamide (PubChem CID 132655322) has the molecular formula C22H28N2OS and a molecular weight of 368.55 g/mol. Its IUPAC name is N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-methylsulfanylbenzamide.
| Compound Name | N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 132655322 |
| Molecular Formula | C22H28N2OS |
| Molecular Weight | 368.55 g/mol |
| Exact Mass | 368.19 |
| IUPAC Name | N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-methylsulfanylbenzamide |
| SMILES | CSc1ccccc1C(=O)NC(C)c1ccc(N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C22H28N2OS/c1-16-12-14-24(15-13-16)19-10-8-18(9-11-19)17(2)23-22(25)20-6-4-5-7-21(20)26-3/h4-11,16-17H,12-15H2,1-3H3,(H,23,25) |
| InChIKey | VMGQXNVQXBCNEO-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.55 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|