C22H29NO — CID 133230614
N-[1-(4-tert-butylphenyl)ethyl]-2,4,5-trimethylbenzamide (PubChem CID 133230614) has the molecular formula C22H29NO and a molecular weight of 323.48 g/mol. Its IUPAC name is N-[1-(4-tert-butylphenyl)ethyl]-2,4,5-trimethylbenzamide.
| Compound Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4,5-trimethylbenzamide |
|---|---|
| PubChem CID | 133230614 |
| Molecular Formula | C22H29NO |
| Molecular Weight | 323.48 g/mol |
| Exact Mass | 323.22 |
| IUPAC Name | N-[1-(4-tert-butylphenyl)ethyl]-2,4,5-trimethylbenzamide |
| SMILES | Cc1cc(C)c(C(=O)NC(C)c2ccc(C(C)(C)C)cc2)cc1C |
| InChI | InChI=1S/C22H29NO/c1-14-12-16(3)20(13-15(14)2)21(24)23-17(4)18-8-10-19(11-9-18)22(5,6)7/h8-13,17H,1-7H3,(H,23,24) |
| InChIKey | LVPOLYJUFAEVDG-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.48 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |