C20H25NO — CID 100712064
N-[(1S)-1-(4-ethylphenyl)ethyl]-2,4,5-trimethylbenzamide (PubChem CID 100712064) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N-[(1S)-1-(4-ethylphenyl)ethyl]-2,4,5-trimethylbenzamide.
| Compound Name | N-[(1S)-1-(4-ethylphenyl)ethyl]-2,4,5-trimethylbenzamide |
|---|---|
| PubChem CID | 100712064 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N-[(1S)-1-(4-ethylphenyl)ethyl]-2,4,5-trimethylbenzamide |
| SMILES | CCc1ccc([C@H](C)NC(=O)c2cc(C)c(C)cc2C)cc1 |
| InChI | InChI=1S/C20H25NO/c1-6-17-7-9-18(10-8-17)16(5)21-20(22)19-12-14(3)13(2)11-15(19)4/h7-12,16H,6H2,1-5H3,(H,21,22)/t16-/m0/s1 |
| InChIKey | KXOAEAWAEFQFGK-INIZCTEOSA-N |
| XLogP | 4.67 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |