C26H30N2O2 — CID 132661788
N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide (PubChem CID 132661788) has the molecular formula C26H30N2O2 and a molecular weight of 402.54 g/mol. Its IUPAC name is N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide.
| Compound Name | N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide |
|---|---|
| PubChem CID | 132661788 |
| Molecular Formula | C26H30N2O2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | N-[1-[4-(4-methylpiperidin-1-yl)phenyl]ethyl]-2-naphthalen-2-yloxyacetamide |
| SMILES | CC1CCN(c2ccc(C(C)NC(=O)COc3ccc4ccccc4c3)cc2)CC1 |
| InChI | InChI=1S/C26H30N2O2/c1-19-13-15-28(16-14-19)24-10-7-21(8-11-24)20(2)27-26(29)18-30-25-12-9-22-5-3-4-6-23(22)17-25/h3-12,17,19-20H,13-16,18H2,1-2H3,(H,27,29) |
| InChIKey | BFZQEJOUSZNKKW-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|