C17H14F3N5O2 — CID 117074401
N-[(1-pyridin-4-yltriazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide (PubChem CID 117074401) has the molecular formula C17H14F3N5O2 and a molecular weight of 377.33 g/mol. Its IUPAC name is N-[(1-pyridin-4-yltriazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide.
| Compound Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
|---|---|
| PubChem CID | 117074401 |
| Molecular Formula | C17H14F3N5O2 |
| Molecular Weight | 377.33 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | N-[(1-pyridin-4-yltriazol-4-yl)methyl]-2-[3-(trifluoromethyl)phenoxy]acetamide |
| SMILES | O=C(COc1cccc(C(F)(F)F)c1)NCc1cn(-c2ccncc2)nn1 |
| InChI | InChI=1S/C17H14F3N5O2/c18-17(19,20)12-2-1-3-15(8-12)27-11-16(26)22-9-13-10-25(24-23-13)14-4-6-21-7-5-14/h1-8,10H,9,11H2,(H,22,26) |
| InChIKey | ZJZYJKYIWXPXAS-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.33 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |