C17H19ClN2O5 — CID 55425680
[2-(3,4-diethoxyanilino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 55425680) has the molecular formula C17H19ClN2O5 and a molecular weight of 366.80 g/mol. Its IUPAC name is [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 55425680 |
| Molecular Formula | C17H19ClN2O5 |
| Molecular Weight | 366.80 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | [2-(3,4-diethoxyanilino)-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | CCOc1ccc(NC(=O)COC(=O)c2cc(Cl)c[nH]2)cc1OCC |
| InChI | InChI=1S/C17H19ClN2O5/c1-3-23-14-6-5-12(8-15(14)24-4-2)20-16(21)10-25-17(22)13-7-11(18)9-19-13/h5-9,19H,3-4,10H2,1-2H3,(H,20,21) |
| InChIKey | RHSXYHPXBVFQPU-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.80 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |