C15H14ClN3O4 — CID 18123039
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate (PubChem CID 18123039) has the molecular formula C15H14ClN3O4 and a molecular weight of 335.75 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 18123039 |
| Molecular Formula | C15H14ClN3O4 |
| Molecular Weight | 335.75 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 4-chloro-1H-pyrrole-2-carboxylate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)c2cc(Cl)c[nH]2)cc1 |
| InChI | InChI=1S/C15H14ClN3O4/c1-17-14(21)9-2-4-11(5-3-9)19-13(20)8-23-15(22)12-6-10(16)7-18-12/h2-7,18H,8H2,1H3,(H,17,21)(H,19,20) |
| InChIKey | LUMQBISBYQGSLZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 100.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.75 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |