C24H25FN2O4S — CID 38518080
N-benzyl-4-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2-methoxyethyl)benzamide (PubChem CID 38518080) has the molecular formula C24H25FN2O4S and a molecular weight of 456.54 g/mol. Its IUPAC name is N-benzyl-4-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2-methoxyethyl)benzamide.
| Compound Name | N-benzyl-4-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 38518080 |
| Molecular Formula | C24H25FN2O4S |
| Molecular Weight | 456.54 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | N-benzyl-4-[(4-fluoro-3-methylphenyl)sulfonylamino]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1ccccc1)C(=O)c1ccc(NS(=O)(=O)c2ccc(F)c(C)c2)cc1 |
| InChI | InChI=1S/C24H25FN2O4S/c1-18-16-22(12-13-23(18)25)32(29,30)26-21-10-8-20(9-11-21)24(28)27(14-15-31-2)17-19-6-4-3-5-7-19/h3-13,16,26H,14-15,17H2,1-2H3 |
| InChIKey | SBWGDPDHLVDODB-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |