C21H24N2O4S — CID 35742507
4-[(4-ethoxyphenyl)sulfamoyl]-N,N-bis(prop-2-enyl)benzamide (PubChem CID 35742507) has the molecular formula C21H24N2O4S and a molecular weight of 400.50 g/mol. Its IUPAC name is 4-[(4-ethoxyphenyl)sulfamoyl]-N,N-bis(prop-2-enyl)benzamide.
| Compound Name | 4-[(4-ethoxyphenyl)sulfamoyl]-N,N-bis(prop-2-enyl)benzamide |
|---|---|
| PubChem CID | 35742507 |
| Molecular Formula | C21H24N2O4S |
| Molecular Weight | 400.50 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | 4-[(4-ethoxyphenyl)sulfamoyl]-N,N-bis(prop-2-enyl)benzamide |
| SMILES | C=CCN(CC=C)C(=O)c1ccc(S(=O)(=O)Nc2ccc(OCC)cc2)cc1 |
| InChI | InChI=1S/C21H24N2O4S/c1-4-15-23(16-5-2)21(24)17-7-13-20(14-8-17)28(25,26)22-18-9-11-19(12-10-18)27-6-3/h4-5,7-14,22H,1-2,6,15-16H2,3H3 |
| InChIKey | ORXJUYZATFCYJU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|