C22H29N3O5S — CID 24659018
N-[2-(tert-butylamino)-2-oxoethyl]-4-[(4-ethoxyphenyl)sulfonylamino]-N-methylbenzamide (PubChem CID 24659018) has the molecular formula C22H29N3O5S and a molecular weight of 447.56 g/mol. Its IUPAC name is N-[2-(tert-butylamino)-2-oxoethyl]-4-[(4-ethoxyphenyl)sulfonylamino]-N-methylbenzamide.
| Compound Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-[(4-ethoxyphenyl)sulfonylamino]-N-methylbenzamide |
|---|---|
| PubChem CID | 24659018 |
| Molecular Formula | C22H29N3O5S |
| Molecular Weight | 447.56 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-[2-(tert-butylamino)-2-oxoethyl]-4-[(4-ethoxyphenyl)sulfonylamino]-N-methylbenzamide |
| SMILES | CCOc1ccc(S(=O)(=O)Nc2ccc(C(=O)N(C)CC(=O)NC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O5S/c1-6-30-18-11-13-19(14-12-18)31(28,29)24-17-9-7-16(8-10-17)21(27)25(5)15-20(26)23-22(2,3)4/h7-14,24H,6,15H2,1-5H3,(H,23,26) |
| InChIKey | BLEXQDIWVZBTCV-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.56 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |