C25H27N3O5 — CID 102086422
(2S)-2-benzamido-3-[4-[3-[(4-methyl-2-pyridinyl)amino]propylperoxy]phenyl]propanoic acid (PubChem CID 102086422) has the molecular formula C25H27N3O5 and a molecular weight of 449.51 g/mol. Its IUPAC name is (2S)-2-benzamido-3-[4-[3-[(4-methyl-2-pyridinyl)amino]propylperoxy]phenyl]propanoic acid.
| Compound Name | (2S)-2-benzamido-3-[4-[3-[(4-methyl-2-pyridinyl)amino]propylperoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 102086422 |
| Molecular Formula | C25H27N3O5 |
| Molecular Weight | 449.51 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | (2S)-2-benzamido-3-[4-[3-[(4-methyl-2-pyridinyl)amino]propylperoxy]phenyl]propanoic acid |
| SMILES | Cc1ccnc(NCCCOOc2ccc(C[C@H](NC(=O)c3ccccc3)C(=O)O)cc2)c1 |
| InChI | InChI=1S/C25H27N3O5/c1-18-12-14-27-23(16-18)26-13-5-15-32-33-21-10-8-19(9-11-21)17-22(25(30)31)28-24(29)20-6-3-2-4-7-20/h2-4,6-12,14,16,22H,5,13,15,17H2,1H3,(H,26,27)(H,28,29)(H,30,31)/t22-/m0/s1 |
| InChIKey | DJJNBYUGQCMXRK-QFIPXVFZSA-N |
| XLogP | 3.63 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.51 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|