C21H27F3N6O2 — CID 175520446
4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl 4-amino-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate (PubChem CID 175520446) has the molecular formula C21H27F3N6O2 and a molecular weight of 452.48 g/mol. Its IUPAC name is 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl 4-amino-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate.
| Compound Name | 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl 4-amino-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate |
|---|---|
| PubChem CID | 175520446 |
| Molecular Formula | C21H27F3N6O2 |
| Molecular Weight | 452.48 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl 4-amino-2-[[2-(trifluoromethyl)pyrimidin-4-yl]amino]butanoate |
| SMILES | NCCC(Nc1ccnc(C(F)(F)F)n1)C(=O)OCCCCc1ccc2c(n1)NCCC2 |
| InChI | InChI=1S/C21H27F3N6O2/c22-21(23,24)20-27-12-9-17(30-20)29-16(8-10-25)19(31)32-13-2-1-5-15-7-6-14-4-3-11-26-18(14)28-15/h6-7,9,12,16H,1-5,8,10-11,13,25H2,(H,26,28)(H,27,29,30) |
| InChIKey | OLGIGQSVXJLVHF-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 115.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|