C33H47FN4O6 — CID 139463459
tert-butyl 7-[4-[3-fluoropropyl-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 139463459) has the molecular formula C33H47FN4O6 and a molecular weight of 614.76 g/mol. Its IUPAC name is tert-butyl 7-[4-[3-fluoropropyl-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[4-[3-fluoropropyl-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 139463459 |
| Molecular Formula | C33H47FN4O6 |
| Molecular Weight | 614.76 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | tert-butyl 7-[4-[3-fluoropropyl-[4-methoxy-4-oxo-3-(phenylmethoxycarbonylamino)butyl]amino]butyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | COC(=O)C(CCN(CCCF)CCCCc1ccc2c(n1)N(C(=O)OC(C)(C)C)CCC2)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H47FN4O6/c1-33(2,3)44-32(41)38-22-10-14-26-16-17-27(35-29(26)38)15-8-9-20-37(21-11-19-34)23-18-28(30(39)42-4)36-31(40)43-24-25-12-6-5-7-13-25/h5-7,12-13,16-17,28H,8-11,14-15,18-24H2,1-4H3,(H,36,40) |
| InChIKey | NBEIUYCGVXOHKU-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 110.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.76 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|