C34H36N4O10 — CID 11513063
tert-butyl 7-[2-[4-[[(Z)-1-(1,3-benzodioxol-5-yl)-3-ethoxy-3-oxoprop-1-enyl]-formylamino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate (PubChem CID 11513063) has the molecular formula C34H36N4O10 and a molecular weight of 660.68 g/mol. Its IUPAC name is tert-butyl 7-[2-[4-[[(Z)-1-(1,3-benzodioxol-5-yl)-3-ethoxy-3-oxoprop-1-enyl]-formylamino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate.
| Compound Name | tert-butyl 7-[2-[4-[[(Z)-1-(1,3-benzodioxol-5-yl)-3-ethoxy-3-oxoprop-1-enyl]-formylamino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
|---|---|
| PubChem CID | 11513063 |
| Molecular Formula | C34H36N4O10 |
| Molecular Weight | 660.68 g/mol |
| Exact Mass | 660.24 |
| IUPAC Name | tert-butyl 7-[2-[4-[[(Z)-1-(1,3-benzodioxol-5-yl)-3-ethoxy-3-oxoprop-1-enyl]-formylamino]-3-nitrophenoxy]ethyl]-3,4-dihydro-2H-1,8-naphthyridine-1-carboxylate |
| SMILES | CCOC(=O)/C=C(/c1ccc2c(c1)OCO2)N(C=O)c1ccc(OCCc2ccc3c(n2)N(C(=O)OC(C)(C)C)CCC3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C34H36N4O10/c1-5-44-31(40)19-27(23-9-13-29-30(17-23)47-21-46-29)37(20-39)26-12-11-25(18-28(26)38(42)43)45-16-14-24-10-8-22-7-6-15-36(32(22)35-24)33(41)48-34(2,3)4/h8-13,17-20H,5-7,14-16,21H2,1-4H3/b27-19- |
| InChIKey | JANWQOFNWOYFKL-DIBXZPPDSA-N |
| XLogP | 5.59 |
| TPSA | 159.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.68 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|