C20H28N6O6S — CID 24546014
N,N-diethyl-4-[4-(1-methyl-6-oxo-4,5-dihydropyridazine-3-carbonyl)piperazin-1-yl]-3-nitrobenzenesulfonamide (PubChem CID 24546014) has the molecular formula C20H28N6O6S and a molecular weight of 480.55 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(1-methyl-6-oxo-4,5-dihydropyridazine-3-carbonyl)piperazin-1-yl]-3-nitrobenzenesulfonamide.
| Compound Name | N,N-diethyl-4-[4-(1-methyl-6-oxo-4,5-dihydropyridazine-3-carbonyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 24546014 |
| Molecular Formula | C20H28N6O6S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.18 |
| IUPAC Name | N,N-diethyl-4-[4-(1-methyl-6-oxo-4,5-dihydropyridazine-3-carbonyl)piperazin-1-yl]-3-nitrobenzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(N2CCN(C(=O)C3=NN(C)C(=O)CC3)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H28N6O6S/c1-4-25(5-2)33(31,32)15-6-8-17(18(14-15)26(29)30)23-10-12-24(13-11-23)20(28)16-7-9-19(27)22(3)21-16/h6,8,14H,4-5,7,9-13H2,1-3H3 |
| InChIKey | WXJAVOZORXOSAK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 136.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|