C21H28N2O4 — CID 32603172
N-benzyl-1-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperidine-4-carboxamide (PubChem CID 32603172) has the molecular formula C21H28N2O4 and a molecular weight of 372.46 g/mol. Its IUPAC name is N-benzyl-1-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 32603172 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.46 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | N-benzyl-1-[(2R)-3-(furan-2-ylmethoxy)-2-hydroxypropyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C[C@@H](O)COCc2ccco2)CC1 |
| InChI | InChI=1S/C21H28N2O4/c24-19(15-26-16-20-7-4-12-27-20)14-23-10-8-18(9-11-23)21(25)22-13-17-5-2-1-3-6-17/h1-7,12,18-19,24H,8-11,13-16H2,(H,22,25)/t19-/m1/s1 |
| InChIKey | MKFLOLLUYACQHH-LJQANCHMSA-N |
| XLogP | 2.19 |
| TPSA | 74.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |