C13H12F2O2 — CID 115830159
1-(2,6-difluorophenyl)-3-(furan-2-yl)propan-2-ol (PubChem CID 115830159) has the molecular formula C13H12F2O2 and a molecular weight of 238.23 g/mol. Its IUPAC name is 1-(2,6-difluorophenyl)-3-(furan-2-yl)propan-2-ol.
| Compound Name | 1-(2,6-difluorophenyl)-3-(furan-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 115830159 |
| Molecular Formula | C13H12F2O2 |
| Molecular Weight | 238.23 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 1-(2,6-difluorophenyl)-3-(furan-2-yl)propan-2-ol |
| SMILES | OC(Cc1ccco1)Cc1c(F)cccc1F |
| InChI | InChI=1S/C13H12F2O2/c14-12-4-1-5-13(15)11(12)8-9(16)7-10-3-2-6-17-10/h1-6,9,16H,7-8H2 |
| InChIKey | DVWRQRAYOCADJB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.23 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |