C14H17N3O2 — CID 698192
3,5-dimethyl-1-[(1S)-1-(4-methylphenyl)-2-nitroethyl]pyrazole (PubChem CID 698192) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 3,5-dimethyl-1-[(1S)-1-(4-methylphenyl)-2-nitroethyl]pyrazole.
| Compound Name | 3,5-dimethyl-1-[(1S)-1-(4-methylphenyl)-2-nitroethyl]pyrazole |
|---|---|
| PubChem CID | 698192 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 3,5-dimethyl-1-[(1S)-1-(4-methylphenyl)-2-nitroethyl]pyrazole |
| SMILES | Cc1ccc([C@@H](C[N+](=O)[O-])n2nc(C)cc2C)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-10-4-6-13(7-5-10)14(9-16(18)19)17-12(3)8-11(2)15-17/h4-8,14H,9H2,1-3H3/t14-/m1/s1 |
| InChIKey | TYYALHMLOJAUQA-CQSZACIVSA-N |
| XLogP | 2.67 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|