C17H18N4O4S2 — CID 122264826
N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-2-nitrobenzenesulfonamide (PubChem CID 122264826) has the molecular formula C17H18N4O4S2 and a molecular weight of 406.49 g/mol. Its IUPAC name is N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 122264826 |
| Molecular Formula | C17H18N4O4S2 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | N-[2-(3,5-dimethylpyrazol-1-yl)-2-thiophen-2-ylethyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc(C)n(C(CNS(=O)(=O)c2ccccc2[N+](=O)[O-])c2cccs2)n1 |
| InChI | InChI=1S/C17H18N4O4S2/c1-12-10-13(2)20(19-12)15(16-7-5-9-26-16)11-18-27(24,25)17-8-4-3-6-14(17)21(22)23/h3-10,15,18H,11H2,1-2H3 |
| InChIKey | NOVIRJZTIVTMPJ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|