C14H25NO6 — CID 25147127
ethyl (E,4S,5R)-6,6-dimethoxy-5-(nitromethyl)-4-propan-2-ylhex-2-enoate (PubChem CID 25147127) has the molecular formula C14H25NO6 and a molecular weight of 303.36 g/mol. Its IUPAC name is ethyl (E,4S,5R)-6,6-dimethoxy-5-(nitromethyl)-4-propan-2-ylhex-2-enoate.
| Compound Name | ethyl (E,4S,5R)-6,6-dimethoxy-5-(nitromethyl)-4-propan-2-ylhex-2-enoate |
|---|---|
| PubChem CID | 25147127 |
| Molecular Formula | C14H25NO6 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.17 |
| IUPAC Name | ethyl (E,4S,5R)-6,6-dimethoxy-5-(nitromethyl)-4-propan-2-ylhex-2-enoate |
| SMILES | CCOC(=O)/C=C/[C@H](C(C)C)[C@H](C[N+](=O)[O-])C(OC)OC |
| InChI | InChI=1S/C14H25NO6/c1-6-21-13(16)8-7-11(10(2)3)12(9-15(17)18)14(19-4)20-5/h7-8,10-12,14H,6,9H2,1-5H3/b8-7+/t11-,12+/m1/s1 |
| InChIKey | NZMFPWOBPWSIKC-LASXONHFSA-N |
| XLogP | 1.89 |
| TPSA | 87.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|