About (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal
(2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal (PubChem CID 71421872) has the molecular formula C13H25NO5
and a molecular weight of 275.34 g/mol. Its IUPAC name is (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal.
Molecular Properties
| Compound Name | (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal |
| PubChem CID | 71421872 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal |
| SMILES | CCCCCC[C@@H](C=O)[C@H](C[N+](=O)[O-])C(OC)OC |
| InChI | InChI=1S/C13H25NO5/c1-4-5-6-7-8-11(10-15)12(9-14(16)17)13(18-2)19-3/h10-13H,4-9H2,1-3H3/t11-,12-/m0/s1 |
| InChIKey | CXQLWHWYBVQWRB-RYUDHWBXSA-N |
| XLogP | 2.28 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal?
The IUPAC name of (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal (CID 71421872) is (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal.
What is the SMILES notation for (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal?
The canonical SMILES for (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal is CCCCCC[C@@H](C=O)[C@H](C[N+](=O)[O-])C(OC)OC.
What is the InChIKey of (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal?
The InChIKey is CXQLWHWYBVQWRB-RYUDHWBXSA-N. The full InChI is InChI=1S/C13H25NO5/c1-4-5-6-7-8-11(10-15)12(9-14(16)17)13(18-2)19-3/h10-13H,4-9H2,1-3H3/t11-,12-/m0/s1.
What are the key properties of (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal?
(2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal has a molecular weight of 275.34 g/mol, XLogP of 2.28, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2R)-1,1-dimethoxy-3-nitropropan-2-yl]octanal is sourced from PubChem (CID 71421872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).