C10H13F3N2O6 — CID 46869172
ethyl (3S,4S)-3-formyl-5-nitro-4-[(2,2,2-trifluoroacetyl)amino]pentanoate (PubChem CID 46869172) has the molecular formula C10H13F3N2O6 and a molecular weight of 314.22 g/mol. Its IUPAC name is ethyl (3S,4S)-3-formyl-5-nitro-4-[(2,2,2-trifluoroacetyl)amino]pentanoate.
| Compound Name | ethyl (3S,4S)-3-formyl-5-nitro-4-[(2,2,2-trifluoroacetyl)amino]pentanoate |
|---|---|
| PubChem CID | 46869172 |
| Molecular Formula | C10H13F3N2O6 |
| Molecular Weight | 314.22 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl (3S,4S)-3-formyl-5-nitro-4-[(2,2,2-trifluoroacetyl)amino]pentanoate |
| SMILES | CCOC(=O)C[C@H](C=O)[C@@H](C[N+](=O)[O-])NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3N2O6/c1-2-21-8(17)3-6(5-16)7(4-15(19)20)14-9(18)10(11,12)13/h5-7H,2-4H2,1H3,(H,14,18)/t6-,7-/m1/s1 |
| InChIKey | VIYLULKFRDHWGS-RNFRBKRXSA-N |
| XLogP | 0.08 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.22 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|