C19H37NO6 — CID 86754028
2-methylidenedodecanamide;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal (PubChem CID 86754028) has the molecular formula C19H37NO6 and a molecular weight of 375.51 g/mol. Its IUPAC name is 2-methylidenedodecanamide;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal.
| Compound Name | 2-methylidenedodecanamide;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
|---|---|
| PubChem CID | 86754028 |
| Molecular Formula | C19H37NO6 |
| Molecular Weight | 375.51 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | 2-methylidenedodecanamide;(2S,3R,4R,5S)-2,3,4,5-tetrahydroxyhexanal |
| SMILES | C=C(CCCCCCCCCC)C(N)=O.C[C@H](O)[C@@H](O)[C@@H](O)[C@H](O)C=O |
| InChI | InChI=1S/C13H25NO.C6H12O5/c1-3-4-5-6-7-8-9-10-11-12(2)13(14)15;1-3(8)5(10)6(11)4(9)2-7/h2-11H2,1H3,(H2,14,15);2-6,8-11H,1H3/t;3-,4+,5+,6-/m.0/s1 |
| InChIKey | IAYVSZLXDDGPSS-LNEKJHARSA-N |
| XLogP | 1.21 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.51 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|