C9H14O6 — CID 146448376
furan;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal (PubChem CID 146448376) has the molecular formula C9H14O6 and a molecular weight of 218.21 g/mol. Its IUPAC name is furan;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal.
| Compound Name | furan;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
|---|---|
| PubChem CID | 146448376 |
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.08 |
| IUPAC Name | furan;(2S,3R,4R)-2,3,4,5-tetrahydroxypentanal |
| SMILES | O=C[C@@H](O)[C@H](O)[C@H](O)CO.c1ccoc1 |
| InChI | InChI=1S/C5H10O5.C4H4O/c6-1-3(8)5(10)4(9)2-7;1-2-4-5-3-1/h1,3-5,7-10H,2H2;1-4H/t3-,4-,5+;/m1./s1 |
| InChIKey | NXNXMQPQIBGGKP-ZDQHTEEMSA-N |
| XLogP | -1.46 |
| TPSA | 111.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|