C10H24N4O9S — CID 158988010
bis(2-aminoacetic acid);(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 158988010) has the molecular formula C10H24N4O9S and a molecular weight of 376.39 g/mol. Its IUPAC name is bis(2-aminoacetic acid);(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | bis(2-aminoacetic acid);(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 158988010 |
| Molecular Formula | C10H24N4O9S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | bis(2-aminoacetic acid);(2S)-2-amino-3-hydroxypropanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | NCC(=O)O.NCC(=O)O.N[C@@H](CO)C(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C3H7NO3.C3H7NO2S.2C2H5NO2/c4-2(1-5)3(6)7;4-2(1-7)3(5)6;2*3-1-2(4)5/h2,5H,1,4H2,(H,6,7);2,7H,1,4H2,(H,5,6);2*1,3H2,(H,4,5)/t2*2-;;/m00../s1 |
| InChIKey | JPUTXVYZGCAUNM-NVKWYWNSSA-N |
| XLogP | -4.22 |
| TPSA | 273.51 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -4.22 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|