C11H25N3O6S — CID 87699670
2-aminoacetic acid;(2S)-2-amino-4-methylpentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid (PubChem CID 87699670) has the molecular formula C11H25N3O6S and a molecular weight of 327.40 g/mol. Its IUPAC name is 2-aminoacetic acid;(2S)-2-amino-4-methylpentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid.
| Compound Name | 2-aminoacetic acid;(2S)-2-amino-4-methylpentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 87699670 |
| Molecular Formula | C11H25N3O6S |
| Molecular Weight | 327.40 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | 2-aminoacetic acid;(2S)-2-amino-4-methylpentanoic acid;(2R)-2-amino-3-sulfanylpropanoic acid |
| SMILES | CC(C)C[C@H](N)C(=O)O.NCC(=O)O.N[C@@H](CS)C(=O)O |
| InChI | InChI=1S/C6H13NO2.C3H7NO2S.C2H5NO2/c1-4(2)3-5(7)6(8)9;4-2(1-7)3(5)6;3-1-2(4)5/h4-5H,3,7H2,1-2H3,(H,8,9);2,7H,1,4H2,(H,5,6);1,3H2,(H,4,5)/t5-;2-;/m00./s1 |
| InChIKey | FDTDOQBXSHIVFY-GDOBSTBCSA-N |
| XLogP | -1.20 |
| TPSA | 189.96 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.40 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|