C16H31N5O6 — CID 18744848
6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18744848) has the molecular formula C16H31N5O6 and a molecular weight of 389.45 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18744848 |
| Molecular Formula | C16H31N5O6 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2-amino-3-hydroxypropanoyl)amino]-3-methylbutanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CC(C)C(NC(=O)C(N)CO)C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C16H31N5O6/c1-9(2)13(21-14(24)10(18)8-22)15(25)19-7-12(23)20-11(16(26)27)5-3-4-6-17/h9-11,13,22H,3-8,17-18H2,1-2H3,(H,19,25)(H,20,23)(H,21,24)(H,26,27) |
| InChIKey | CEAAMLKLMIYTOS-UHFFFAOYSA-N |
| XLogP | -2.74 |
| TPSA | 196.87 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | -2.74 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|