C20H35N7O9 — CID 88611259
(2S)-5-amino-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid (PubChem CID 88611259) has the molecular formula C20H35N7O9 and a molecular weight of 517.54 g/mol. Its IUPAC name is (2S)-5-amino-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 88611259 |
| Molecular Formula | C20H35N7O9 |
| Molecular Weight | 517.54 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2S)-5-amino-2-[[(2S)-5-amino-2-[[2-[[(2S)-2-[[(2S)-2-amino-3-hydroxypropanoyl]amino]-3-methylbutanoyl]amino]acetyl]amino]-5-oxopentanoyl]amino]-5-oxopentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)[C@@H](N)CO)C(=O)NCC(=O)N[C@@H](CCC(N)=O)C(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C20H35N7O9/c1-9(2)16(27-17(32)10(21)8-28)19(34)24-7-15(31)25-11(3-5-13(22)29)18(33)26-12(20(35)36)4-6-14(23)30/h9-12,16,28H,3-8,21H2,1-2H3,(H2,22,29)(H2,23,30)(H,24,34)(H,25,31)(H,26,33)(H,27,32)(H,35,36)/t10-,11-,12-,16-/m0/s1 |
| InChIKey | YLTNJTBHGSNFTA-YWDSYVAPSA-N |
| XLogP | -4.85 |
| TPSA | 286.13 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.54 |
| LogP ≤ 5 | -4.85 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |