C19H36N6O6 — CID 18480508
6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]acetyl]amino]hexanoic acid (PubChem CID 18480508) has the molecular formula C19H36N6O6 and a molecular weight of 444.53 g/mol. Its IUPAC name is 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18480508 |
| Molecular Formula | C19H36N6O6 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | 6-amino-2-[[2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]-3-methylpentanoyl]amino]acetyl]amino]hexanoic acid |
| SMILES | CCC(C)C(NC(=O)C(N)CCC(N)=O)C(=O)NCC(=O)NC(CCCCN)C(=O)O |
| InChI | InChI=1S/C19H36N6O6/c1-3-11(2)16(25-17(28)12(21)7-8-14(22)26)18(29)23-10-15(27)24-13(19(30)31)6-4-5-9-20/h11-13,16H,3-10,20-21H2,1-2H3,(H2,22,26)(H,23,29)(H,24,27)(H,25,28)(H,30,31) |
| InChIKey | XSYQBWGJRPWUIK-UHFFFAOYSA-N |
| XLogP | -2.08 |
| TPSA | 219.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | -2.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|