C18H33N7O7 — CID 18479691
6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-5-oxopentanoyl]amino]hexanoic acid (PubChem CID 18479691) has the molecular formula C18H33N7O7 and a molecular weight of 459.50 g/mol. Its IUPAC name is 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-5-oxopentanoyl]amino]hexanoic acid.
| Compound Name | 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 18479691 |
| Molecular Formula | C18H33N7O7 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 6-amino-2-[[5-amino-2-[[2-[(2,5-diamino-5-oxopentanoyl)amino]acetyl]amino]-5-oxopentanoyl]amino]hexanoic acid |
| SMILES | NCCCCC(NC(=O)C(CCC(N)=O)NC(=O)CNC(=O)C(N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C18H33N7O7/c19-8-2-1-3-12(18(31)32)25-17(30)11(5-7-14(22)27)24-15(28)9-23-16(29)10(20)4-6-13(21)26/h10-12H,1-9,19-20H2,(H2,21,26)(H2,22,27)(H,23,29)(H,24,28)(H,25,30)(H,31,32) |
| InChIKey | UDAHRSJTWVFEPD-UHFFFAOYSA-N |
| XLogP | -3.86 |
| TPSA | 262.82 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | -3.86 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|