C17H30N6O8 — CID 18303647
5-amino-2-[[2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid (PubChem CID 18303647) has the molecular formula C17H30N6O8 and a molecular weight of 446.46 g/mol. Its IUPAC name is 5-amino-2-[[2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[[2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 18303647 |
| Molecular Formula | C17H30N6O8 |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | 5-amino-2-[[2-[[3-carboxy-2-(2,6-diaminohexanoylamino)propanoyl]amino]acetyl]amino]-5-oxopentanoic acid |
| SMILES | NCCCCC(N)C(=O)NC(CC(=O)O)C(=O)NCC(=O)NC(CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C17H30N6O8/c18-6-2-1-3-9(19)15(28)23-11(7-14(26)27)16(29)21-8-13(25)22-10(17(30)31)4-5-12(20)24/h9-11H,1-8,18-19H2,(H2,20,24)(H,21,29)(H,22,25)(H,23,28)(H,26,27)(H,30,31) |
| InChIKey | MFIBLYBIUCUKMK-UHFFFAOYSA-N |
| XLogP | -3.65 |
| TPSA | 257.03 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | -3.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|