C17H29N5O9 — CID 18304437
2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 18304437) has the molecular formula C17H29N5O9 and a molecular weight of 447.45 g/mol. Its IUPAC name is 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 18304437 |
| Molecular Formula | C17H29N5O9 |
| Molecular Weight | 447.45 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 2-[[2-[[4-carboxy-2-(2,6-diaminohexanoylamino)butanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NCCCCC(N)C(=O)NC(CCC(=O)O)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C17H29N5O9/c18-6-2-1-3-9(19)15(28)22-10(4-5-13(24)25)16(29)20-8-12(23)21-11(17(30)31)7-14(26)27/h9-11H,1-8,18-19H2,(H,20,29)(H,21,23)(H,22,28)(H,24,25)(H,26,27)(H,30,31) |
| InChIKey | DCOIVHYMQYMUHQ-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 251.24 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.45 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|