C12H24N4O5 — CID 145456781
2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]acetic acid (PubChem CID 145456781) has the molecular formula C12H24N4O5 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]acetic acid.
| Compound Name | 2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 145456781 |
| Molecular Formula | C12H24N4O5 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.17 |
| IUPAC Name | 2-[[(2S,3R)-2-[[(2S)-2,6-diaminohexanoyl]amino]-3-hydroxybutanoyl]amino]acetic acid |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCCCN)C(=O)NCC(=O)O |
| InChI | InChI=1S/C12H24N4O5/c1-7(17)10(12(21)15-6-9(18)19)16-11(20)8(14)4-2-3-5-13/h7-8,10,17H,2-6,13-14H2,1H3,(H,15,21)(H,16,20)(H,18,19)/t7-,8+,10+/m1/s1 |
| InChIKey | JHNOXVASMSXSNB-WEDXCCLWSA-N |
| XLogP | -2.49 |
| TPSA | 167.77 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|