C13H21N5O8S — CID 22653818
2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid (PubChem CID 22653818) has the molecular formula C13H21N5O8S and a molecular weight of 407.41 g/mol. Its IUPAC name is 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22653818 |
| Molecular Formula | C13H21N5O8S |
| Molecular Weight | 407.41 g/mol |
| Exact Mass | 407.11 |
| IUPAC Name | 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-sulfanylpropanoyl]amino]acetyl]amino]butanedioic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(CS)C(=O)NCC(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H21N5O8S/c14-5(1-8(15)19)11(23)18-7(4-27)12(24)16-3-9(20)17-6(13(25)26)2-10(21)22/h5-7,27H,1-4,14H2,(H2,15,19)(H,16,24)(H,17,20)(H,18,23)(H,21,22)(H,25,26) |
| InChIKey | RYOHPPXYVPEWAH-UHFFFAOYSA-N |
| XLogP | -4.24 |
| TPSA | 231.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.41 |
| LogP ≤ 5 | -4.24 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|