C22H36N2O7 — CID 159429631
methyl (2S)-2-[[(2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-prop-2-enoxyhexanoyl]amino]hex-5-enoate (PubChem CID 159429631) has the molecular formula C22H36N2O7 and a molecular weight of 440.54 g/mol. Its IUPAC name is methyl (2S)-2-[[(2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-prop-2-enoxyhexanoyl]amino]hex-5-enoate.
| Compound Name | methyl (2S)-2-[[(2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-prop-2-enoxyhexanoyl]amino]hex-5-enoate |
|---|---|
| PubChem CID | 159429631 |
| Molecular Formula | C22H36N2O7 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | methyl (2S)-2-[[(2R,5S)-2-methyl-5-[(2-methylpropan-2-yl)oxycarbonylamino]-4-oxo-6-prop-2-enoxyhexanoyl]amino]hex-5-enoate |
| SMILES | C=CCC[C@H](NC(=O)[C@H](C)CC(=O)[C@H](COCC=C)NC(=O)OC(C)(C)C)C(=O)OC |
| InChI | InChI=1S/C22H36N2O7/c1-8-10-11-16(20(27)29-7)23-19(26)15(3)13-18(25)17(14-30-12-9-2)24-21(28)31-22(4,5)6/h8-9,15-17H,1-2,10-14H2,3-7H3,(H,23,26)(H,24,28)/t15-,16+,17+/m1/s1 |
| InChIKey | NKMYGSFXFNYJHA-IKGGRYGDSA-N |
| XLogP | 2.30 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|