C15H26ClNO3 — CID 87490403
tert-butyl N-[(3S,5S)-1-chloro-5-methyl-2-oxonon-8-en-3-yl]carbamate (PubChem CID 87490403) has the molecular formula C15H26ClNO3 and a molecular weight of 303.83 g/mol. Its IUPAC name is tert-butyl N-[(3S,5S)-1-chloro-5-methyl-2-oxonon-8-en-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,5S)-1-chloro-5-methyl-2-oxonon-8-en-3-yl]carbamate |
|---|---|
| PubChem CID | 87490403 |
| Molecular Formula | C15H26ClNO3 |
| Molecular Weight | 303.83 g/mol |
| Exact Mass | 303.16 |
| IUPAC Name | tert-butyl N-[(3S,5S)-1-chloro-5-methyl-2-oxonon-8-en-3-yl]carbamate |
| SMILES | C=CCC[C@H](C)C[C@H](NC(=O)OC(C)(C)C)C(=O)CCl |
| InChI | InChI=1S/C15H26ClNO3/c1-6-7-8-11(2)9-12(13(18)10-16)17-14(19)20-15(3,4)5/h6,11-12H,1,7-10H2,2-5H3,(H,17,19)/t11-,12-/m0/s1 |
| InChIKey | VFKOXVVLGHCLNN-RYUDHWBXSA-N |
| XLogP | 3.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.83 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|