C19H35NO4 — CID 144620217
ethyl (3R,5R)-3-ethyl-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoate (PubChem CID 144620217) has the molecular formula C19H35NO4 and a molecular weight of 341.49 g/mol. Its IUPAC name is ethyl (3R,5R)-3-ethyl-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoate.
| Compound Name | ethyl (3R,5R)-3-ethyl-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoate |
|---|---|
| PubChem CID | 144620217 |
| Molecular Formula | C19H35NO4 |
| Molecular Weight | 341.49 g/mol |
| Exact Mass | 341.26 |
| IUPAC Name | ethyl (3R,5R)-3-ethyl-5-methyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]non-8-enoate |
| SMILES | C=CCC[C@@H](C)C[C@@H](CC)C(NC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C19H35NO4/c1-8-11-12-14(4)13-15(9-2)16(17(21)23-10-3)20-18(22)24-19(5,6)7/h8,14-16H,1,9-13H2,2-7H3,(H,20,22)/t14-,15-,16?/m1/s1 |
| InChIKey | ZDICGKFHTVCHTN-YGFGXBMJSA-N |
| XLogP | 4.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.49 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|