C18H32N2O3 — CID 24806082
tert-butyl N-[(2S,3S)-1-[[(1E)-hepta-1,6-dienyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate (PubChem CID 24806082) has the molecular formula C18H32N2O3 and a molecular weight of 324.47 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S)-1-[[(1E)-hepta-1,6-dienyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S)-1-[[(1E)-hepta-1,6-dienyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 24806082 |
| Molecular Formula | C18H32N2O3 |
| Molecular Weight | 324.47 g/mol |
| Exact Mass | 324.24 |
| IUPAC Name | tert-butyl N-[(2S,3S)-1-[[(1E)-hepta-1,6-dienyl]amino]-3-methyl-1-oxopentan-2-yl]carbamate |
| SMILES | C=CCCC/C=C/NC(=O)[C@@H](NC(=O)OC(C)(C)C)[C@@H](C)CC |
| InChI | InChI=1S/C18H32N2O3/c1-7-9-10-11-12-13-19-16(21)15(14(3)8-2)20-17(22)23-18(4,5)6/h7,12-15H,1,8-11H2,2-6H3,(H,19,21)(H,20,22)/b13-12+/t14-,15-/m0/s1 |
| InChIKey | CIIJSVQEADDVDE-SWBCYVRMSA-N |
| XLogP | 3.91 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|