C20H36O4 — CID 147810304
4-O-tert-butyl 1-O-ethyl 2-[(3R)-5-methylnon-8-en-3-yl]butanedioate (PubChem CID 147810304) has the molecular formula C20H36O4 and a molecular weight of 340.50 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-ethyl 2-[(3R)-5-methylnon-8-en-3-yl]butanedioate.
| Compound Name | 4-O-tert-butyl 1-O-ethyl 2-[(3R)-5-methylnon-8-en-3-yl]butanedioate |
|---|---|
| PubChem CID | 147810304 |
| Molecular Formula | C20H36O4 |
| Molecular Weight | 340.50 g/mol |
| Exact Mass | 340.26 |
| IUPAC Name | 4-O-tert-butyl 1-O-ethyl 2-[(3R)-5-methylnon-8-en-3-yl]butanedioate |
| SMILES | C=CCCC(C)C[C@@H](CC)C(CC(=O)OC(C)(C)C)C(=O)OCC |
| InChI | InChI=1S/C20H36O4/c1-8-11-12-15(4)13-16(9-2)17(19(22)23-10-3)14-18(21)24-20(5,6)7/h8,15-17H,1,9-14H2,2-7H3/t15?,16-,17?/m1/s1 |
| InChIKey | HNGDEOBAEMPTHS-AQFXKWCLSA-N |
| XLogP | 4.92 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|