C32H57N3O5 — CID 156858122
ethyl (2S)-2-[[(2S)-2-(2-hex-5-enylnonanoylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate (PubChem CID 156858122) has the molecular formula C32H57N3O5 and a molecular weight of 563.82 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-(2-hex-5-enylnonanoylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-(2-hex-5-enylnonanoylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate |
|---|---|
| PubChem CID | 156858122 |
| Molecular Formula | C32H57N3O5 |
| Molecular Weight | 563.82 g/mol |
| Exact Mass | 563.43 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-(2-hex-5-enylnonanoylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate |
| SMILES | C=CCCCCC(CCCCCCC)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(CC=C)C(=O)NC)C(=O)OCC |
| InChI | InChI=1S/C32H57N3O5/c1-8-12-14-16-18-21-25(20-17-15-13-9-2)30(37)34-27(22-24(5)6)31(38)35-28(32(39)40-11-4)23-26(19-10-3)29(36)33-7/h9-10,24-28H,2-3,8,11-23H2,1,4-7H3,(H,33,36)(H,34,37)(H,35,38)/t25?,26?,27-,28-/m0/s1 |
| InChIKey | XVSIKYSYXPKGEG-PAIGMYNKSA-N |
| XLogP | 5.62 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.82 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|