C30H53N3O6 — CID 156858074
ethyl (2S)-2-[[(2S)-2-(dodec-1-en-5-yloxycarbonylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate (PubChem CID 156858074) has the molecular formula C30H53N3O6 and a molecular weight of 551.77 g/mol. Its IUPAC name is ethyl (2S)-2-[[(2S)-2-(dodec-1-en-5-yloxycarbonylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate.
| Compound Name | ethyl (2S)-2-[[(2S)-2-(dodec-1-en-5-yloxycarbonylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate |
|---|---|
| PubChem CID | 156858074 |
| Molecular Formula | C30H53N3O6 |
| Molecular Weight | 551.77 g/mol |
| Exact Mass | 551.39 |
| IUPAC Name | ethyl (2S)-2-[[(2S)-2-(dodec-1-en-5-yloxycarbonylamino)-4-methylpentanoyl]amino]-4-(methylcarbamoyl)hept-6-enoate |
| SMILES | C=CCCC(CCCCCCC)OC(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC(CC=C)C(=O)NC)C(=O)OCC |
| InChI | InChI=1S/C30H53N3O6/c1-8-12-14-15-16-19-24(18-13-9-2)39-30(37)33-25(20-22(5)6)28(35)32-26(29(36)38-11-4)21-23(17-10-3)27(34)31-7/h9-10,22-26H,2-3,8,11-21H2,1,4-7H3,(H,31,34)(H,32,35)(H,33,37)/t23?,24?,25-,26-/m0/s1 |
| InChIKey | CKAWNIGVPYARGV-HDLCADABSA-N |
| XLogP | 5.20 |
| TPSA | 122.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|