C31H59N3O6 — CID 156857901
ethane;ethyl 2-[[2-[[(Z)-1-(dimethylamino)-2-methyl-1-oxopentadec-4-en-8-yl]oxycarbonylamino]-4-methylpentanoyl]amino]acetate (PubChem CID 156857901) has the molecular formula C31H59N3O6 and a molecular weight of 569.83 g/mol. Its IUPAC name is ethane;ethyl 2-[[2-[[(Z)-1-(dimethylamino)-2-methyl-1-oxopentadec-4-en-8-yl]oxycarbonylamino]-4-methylpentanoyl]amino]acetate.
| Compound Name | ethane;ethyl 2-[[2-[[(Z)-1-(dimethylamino)-2-methyl-1-oxopentadec-4-en-8-yl]oxycarbonylamino]-4-methylpentanoyl]amino]acetate |
|---|---|
| PubChem CID | 156857901 |
| Molecular Formula | C31H59N3O6 |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.44 |
| IUPAC Name | ethane;ethyl 2-[[2-[[(Z)-1-(dimethylamino)-2-methyl-1-oxopentadec-4-en-8-yl]oxycarbonylamino]-4-methylpentanoyl]amino]acetate |
| SMILES | CC.CCCCCCCC(CC/C=C\CC(C)C(=O)N(C)C)OC(=O)NC(CC(C)C)C(=O)NCC(=O)OCC |
| InChI | InChI=1S/C29H53N3O6.C2H6/c1-8-10-11-12-15-18-24(19-16-13-14-17-23(5)28(35)32(6)7)38-29(36)31-25(20-22(3)4)27(34)30-21-26(33)37-9-2;1-2/h13-14,22-25H,8-12,15-21H2,1-7H3,(H,30,34)(H,31,36);1-2H3/b14-13-; |
| InChIKey | KYCPEUJOAWTRNT-HPWRNOGASA-N |
| XLogP | 6.01 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|