C28H34N2O6 — CID 135515232
methyl (2S)-2-[[(2S)-2-[[(Z)-2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene]amino]-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 135515232) has the molecular formula C28H34N2O6 and a molecular weight of 494.59 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(Z)-2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene]amino]-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(Z)-2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene]amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 135515232 |
| Molecular Formula | C28H34N2O6 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(Z)-2-ethoxycarbonyl-3-hydroxy-3-phenylprop-2-enylidene]amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CCOC(=O)C(/C=N/[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(C)C)C(=O)OC)=C(\O)c1ccccc1 |
| InChI | InChI=1S/C28H34N2O6/c1-5-36-27(33)22(25(31)21-14-10-7-11-15-21)18-29-23(17-20-12-8-6-9-13-20)26(32)30-24(16-19(2)3)28(34)35-4/h6-15,18-19,23-24,31H,5,16-17H2,1-4H3,(H,30,32)/b25-22-,29-18+/t23-,24-/m0/s1 |
| InChIKey | GYSIFVLWXIMDIM-ZSAVZMKTSA-N |
| XLogP | 3.90 |
| TPSA | 114.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|