C21H33N3O4 — CID 148821257
methyl 2-[[2-[(3-amino-2-oxopentyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate (PubChem CID 148821257) has the molecular formula C21H33N3O4 and a molecular weight of 391.51 g/mol. Its IUPAC name is methyl 2-[[2-[(3-amino-2-oxopentyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-[(3-amino-2-oxopentyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 148821257 |
| Molecular Formula | C21H33N3O4 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | methyl 2-[[2-[(3-amino-2-oxopentyl)amino]-3-phenylpropanoyl]amino]-4-methylpentanoate |
| SMILES | CCC(N)C(=O)CNC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C21H33N3O4/c1-5-16(22)19(25)13-23-17(12-15-9-7-6-8-10-15)20(26)24-18(11-14(2)3)21(27)28-4/h6-10,14,16-18,23H,5,11-13,22H2,1-4H3,(H,24,26) |
| InChIKey | ORVCSNFRVOTECW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 110.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |