C21H31N3O5 — CID 10740049
methyl (2S)-2-[[(2S)-2-[[(2E)-2-hydroxyiminopentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 10740049) has the molecular formula C21H31N3O5 and a molecular weight of 405.50 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-2-[[(2E)-2-hydroxyiminopentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-2-[[(2E)-2-hydroxyiminopentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10740049 |
| Molecular Formula | C21H31N3O5 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.23 |
| IUPAC Name | methyl (2S)-2-[[(2S)-2-[[(2E)-2-hydroxyiminopentanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | CCC/C(=N\O)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1ccccc1)C(=O)OC |
| InChI | InChI=1S/C21H31N3O5/c1-5-9-16(24-28)19(25)22-17(12-14(2)3)20(26)23-18(21(27)29-4)13-15-10-7-6-8-11-15/h6-8,10-11,14,17-18,28H,5,9,12-13H2,1-4H3,(H,22,25)(H,23,26)/b24-16+/t17-,18-/m0/s1 |
| InChIKey | FIKQBYGGPZYVOL-PKFRKDNISA-N |
| XLogP | 2.05 |
| TPSA | 117.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|