C22H33N3O6 — CID 21125946
methyl 2-[[2-[[4-hydroxy-2-(2-oxoethylamino)butanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate (PubChem CID 21125946) has the molecular formula C22H33N3O6 and a molecular weight of 435.52 g/mol. Its IUPAC name is methyl 2-[[2-[[4-hydroxy-2-(2-oxoethylamino)butanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate.
| Compound Name | methyl 2-[[2-[[4-hydroxy-2-(2-oxoethylamino)butanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 21125946 |
| Molecular Formula | C22H33N3O6 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | methyl 2-[[2-[[4-hydroxy-2-(2-oxoethylamino)butanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoate |
| SMILES | COC(=O)C(Cc1ccccc1)NC(=O)C(CC(C)C)NC(=O)C(CCO)NCC=O |
| InChI | InChI=1S/C22H33N3O6/c1-15(2)13-18(24-20(28)17(9-11-26)23-10-12-27)21(29)25-19(22(30)31-3)14-16-7-5-4-6-8-16/h4-8,12,15,17-19,23,26H,9-11,13-14H2,1-3H3,(H,24,28)(H,25,29) |
| InChIKey | CWLJKUMUVVJIFB-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 133.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|