C19H29ClN2O4 — CID 66847088
hydron;methyl (2S)-2-[[(2S)-2-amino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate;chloride (PubChem CID 66847088) has the molecular formula C19H29ClN2O4 and a molecular weight of 384.90 g/mol. Its IUPAC name is hydron;methyl (2S)-2-[[(2S)-2-amino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate;chloride.
| Compound Name | hydron;methyl (2S)-2-[[(2S)-2-amino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate;chloride |
|---|---|
| PubChem CID | 66847088 |
| Molecular Formula | C19H29ClN2O4 |
| Molecular Weight | 384.90 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | hydron;methyl (2S)-2-[[(2S)-2-amino-3-(4-prop-2-enoxyphenyl)propanoyl]amino]-4-methylpentanoate;chloride |
| SMILES | C=CCOc1ccc(C[C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)OC)cc1.[Cl-].[H+] |
| InChI | InChI=1S/C19H28N2O4.ClH/c1-5-10-25-15-8-6-14(7-9-15)12-16(20)18(22)21-17(11-13(2)3)19(23)24-4;/h5-9,13,16-17H,1,10-12,20H2,2-4H3,(H,21,22);1H/t16-,17-;/m0./s1 |
| InChIKey | DUWQJCCERSWDFG-QJHJCNPRSA-N |
| XLogP | -1.06 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.90 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|