C20H32N2O3 — CID 142041291
(2S)-2-amino-4-methyl-N-[(2S)-1-[4-(2-methylpropoxy)phenyl]-3-oxobutan-2-yl]pentanamide (PubChem CID 142041291) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is (2S)-2-amino-4-methyl-N-[(2S)-1-[4-(2-methylpropoxy)phenyl]-3-oxobutan-2-yl]pentanamide.
| Compound Name | (2S)-2-amino-4-methyl-N-[(2S)-1-[4-(2-methylpropoxy)phenyl]-3-oxobutan-2-yl]pentanamide |
|---|---|
| PubChem CID | 142041291 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (2S)-2-amino-4-methyl-N-[(2S)-1-[4-(2-methylpropoxy)phenyl]-3-oxobutan-2-yl]pentanamide |
| SMILES | CC(=O)[C@H](Cc1ccc(OCC(C)C)cc1)NC(=O)[C@@H](N)CC(C)C |
| InChI | InChI=1S/C20H32N2O3/c1-13(2)10-18(21)20(24)22-19(15(5)23)11-16-6-8-17(9-7-16)25-12-14(3)4/h6-9,13-14,18-19H,10-12,21H2,1-5H3,(H,22,24)/t18-,19-/m0/s1 |
| InChIKey | ZKFRONPVLBFVDV-OALUTQOASA-N |
| XLogP | 2.71 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |