C72H102N2O6 — CID 165402743
[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate (PubChem CID 165402743) has the molecular formula C72H102N2O6 and a molecular weight of 1091.62 g/mol. Its IUPAC name is [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate.
| Compound Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
|---|---|
| PubChem CID | 165402743 |
| Molecular Formula | C72H102N2O6 |
| Molecular Weight | 1091.62 g/mol |
| Exact Mass | 1090.77 |
| IUPAC Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] (2S)-2,6-bis(9H-fluoren-9-ylmethoxycarbonylamino)hexanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCC/C=C\CCCCCCCC)OC(=O)[C@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C72H102N2O6/c1-3-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-45-58(44-32-30-28-26-24-22-20-18-16-14-12-10-8-6-4-2)80-70(75)69(74-72(77)79-57-68-65-52-40-36-48-61(65)62-49-37-41-53-66(62)68)54-42-43-55-73-71(76)78-56-67-63-50-38-34-46-59(63)60-47-35-39-51-64(60)67/h17-20,34-41,46-53,58,67-69H,3-16,21-33,42-45,54-57H2,1-2H3,(H,73,76)(H,74,77)/b19-17-,20-18-/t58?,69-/m0/s1 |
| InChIKey | MMSZPRNTAPOYOF-BQMGFASJSA-N |
| XLogP | 19.98 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1091.62 |
| LogP ≤ 5 | 19.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|