C59H95NO5 — CID 171467297
[(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate (PubChem CID 171467297) has the molecular formula C59H95NO5 and a molecular weight of 898.41 g/mol. Its IUPAC name is [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate.
| Compound Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
|---|---|
| PubChem CID | 171467297 |
| Molecular Formula | C59H95NO5 |
| Molecular Weight | 898.41 g/mol |
| Exact Mass | 897.72 |
| IUPAC Name | [(9Z,27Z)-hexatriaconta-9,27-dien-18-yl] 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-[(2-methylpropan-2-yl)oxy]butanoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCC(CCCCCCC/C=C\CCCCCCCC)OC(=O)C(NC(=O)OCC1c2ccccc2-c2ccccc21)C(C)OC(C)(C)C |
| InChI | InChI=1S/C59H95NO5/c1-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-43-50(42-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-2)64-57(61)56(49(3)65-59(4,5)6)60-58(62)63-48-55-53-46-40-38-44-51(53)52-45-39-41-47-54(52)55/h21-24,38-41,44-47,49-50,55-56H,7-20,25-37,42-43,48H2,1-6H3,(H,60,62)/b23-21-,24-22- |
| InChIKey | DGGDNEXBSNPCDJ-SXAUZNKPSA-N |
| XLogP | 17.47 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.41 |
| LogP ≤ 5 | 17.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|